C23H31NO — CID 88701800
4-methyl-7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)octa-2,4,6-trienamide (PubChem CID 88701800) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is 4-methyl-7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)octa-2,4,6-trienamide.
| Compound Name | 4-methyl-7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)octa-2,4,6-trienamide |
|---|---|
| PubChem CID | 88701800 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 4-methyl-7-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)octa-2,4,6-trienamide |
| SMILES | CC(C=CC(N)=O)=CC=C(C)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H31NO/c1-16(8-12-21(24)25)7-9-17(2)18-10-11-19-20(15-18)23(5,6)14-13-22(19,3)4/h7-12,15H,13-14H2,1-6H3,(H2,24,25) |
| InChIKey | KDFHLTDZKYOTOP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|