About 2,5-diisocyanato-5-prop-2-enoxycyclohexa-1,3-diene
2,5-diisocyanato-5-prop-2-enoxycyclohexa-1,3-diene (PubChem CID 88701890) has the molecular formula C11H10N2O3
and a molecular weight of 218.21 g/mol. Its IUPAC name is 2,5-diisocyanato-5-prop-2-enoxycyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2,5-diisocyanato-5-prop-2-enoxycyclohexa-1,3-diene |
| PubChem CID | 88701890 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2,5-diisocyanato-5-prop-2-enoxycyclohexa-1,3-diene |
| SMILES | C=CCOC1(N=C=O)C=CC(N=C=O)=CC1 |
| InChI | InChI=1S/C11H10N2O3/c1-2-7-16-11(13-9-15)5-3-10(4-6-11)12-8-14/h2-5H,1,6-7H2 |
| InChIKey | WOXBEUNSDALWNO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-diisocyanato-5-prop-2-enoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diisocyanato-5-prop-2-enoxycyclohexa-1,3-diene?
The IUPAC name of 2,5-diisocyanato-5-prop-2-enoxycyclohexa-1,3-diene (CID 88701890) is 2,5-diisocyanato-5-prop-2-enoxycyclohexa-1,3-diene.
What is the SMILES notation for 2,5-diisocyanato-5-prop-2-enoxycyclohexa-1,3-diene?
The canonical SMILES for 2,5-diisocyanato-5-prop-2-enoxycyclohexa-1,3-diene is C=CCOC1(N=C=O)C=CC(N=C=O)=CC1.
What is the InChIKey of 2,5-diisocyanato-5-prop-2-enoxycyclohexa-1,3-diene?
The InChIKey is WOXBEUNSDALWNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O3/c1-2-7-16-11(13-9-15)5-3-10(4-6-11)12-8-14/h2-5H,1,6-7H2.
What are the key properties of 2,5-diisocyanato-5-prop-2-enoxycyclohexa-1,3-diene?
2,5-diisocyanato-5-prop-2-enoxycyclohexa-1,3-diene has a molecular weight of 218.21 g/mol, XLogP of 1.40, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diisocyanato-5-prop-2-enoxycyclohexa-1,3-diene is sourced from PubChem (CID 88701890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).