About 2,2-dimethyl-4-oxido-1,3,4-oxathiazinan-4-ium
2,2-dimethyl-4-oxido-1,3,4-oxathiazinan-4-ium (PubChem CID 88701922) has the molecular formula C5H11NO2S
and a molecular weight of 149.22 g/mol. Its IUPAC name is 2,2-dimethyl-4-oxido-1,3,4-oxathiazinan-4-ium.
Molecular Properties
| Compound Name | 2,2-dimethyl-4-oxido-1,3,4-oxathiazinan-4-ium |
| PubChem CID | 88701922 |
| Molecular Formula | C5H11NO2S |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 2,2-dimethyl-4-oxido-1,3,4-oxathiazinan-4-ium |
| SMILES | CC1(C)OCC[NH+]([O-])S1 |
| InChI | InChI=1S/C5H11NO2S/c1-5(2)8-4-3-6(7)9-5/h6H,3-4H2,1-2H3 |
| InChIKey | MJVLOVZFOWPVGT-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 36.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-4-oxido-1,3,4-oxathiazinan-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-4-oxido-1,3,4-oxathiazinan-4-ium?
The IUPAC name of 2,2-dimethyl-4-oxido-1,3,4-oxathiazinan-4-ium (CID 88701922) is 2,2-dimethyl-4-oxido-1,3,4-oxathiazinan-4-ium.
What is the SMILES notation for 2,2-dimethyl-4-oxido-1,3,4-oxathiazinan-4-ium?
The canonical SMILES for 2,2-dimethyl-4-oxido-1,3,4-oxathiazinan-4-ium is CC1(C)OCC[NH+]([O-])S1.
What is the InChIKey of 2,2-dimethyl-4-oxido-1,3,4-oxathiazinan-4-ium?
The InChIKey is MJVLOVZFOWPVGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2S/c1-5(2)8-4-3-6(7)9-5/h6H,3-4H2,1-2H3.
What are the key properties of 2,2-dimethyl-4-oxido-1,3,4-oxathiazinan-4-ium?
2,2-dimethyl-4-oxido-1,3,4-oxathiazinan-4-ium has a molecular weight of 149.22 g/mol, XLogP of -0.22, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-4-oxido-1,3,4-oxathiazinan-4-ium is sourced from PubChem (CID 88701922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).