C20H24N2O3 — CID 88702048
(1R,9R)-10-ethoxy-4-methoxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbonitrile (PubChem CID 88702048) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (1R,9R)-10-ethoxy-4-methoxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbonitrile.
| Compound Name | (1R,9R)-10-ethoxy-4-methoxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbonitrile |
|---|---|
| PubChem CID | 88702048 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (1R,9R)-10-ethoxy-4-methoxy-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carbonitrile |
| SMILES | CCOC12CCC(=O)C[C@@]13CCN(C#N)[C@@H]2Cc1ccc(OC)cc13 |
| InChI | InChI=1S/C20H24N2O3/c1-3-25-20-7-6-15(23)12-19(20)8-9-22(13-21)18(20)10-14-4-5-16(24-2)11-17(14)19/h4-5,11,18H,3,6-10,12H2,1-2H3/t18-,19-,20?/m1/s1 |
| InChIKey | GTPAFJQZRRXWKM-LEAGNCFPSA-N |
| XLogP | 2.57 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|