C16H24O2 — CID 88702347
[(2E,6E)-2,6-dimethyl-10-methylidenedodeca-2,6,11-trienyl] formate (PubChem CID 88702347) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is [(2E,6E)-2,6-dimethyl-10-methylidenedodeca-2,6,11-trienyl] formate.
| Compound Name | [(2E,6E)-2,6-dimethyl-10-methylidenedodeca-2,6,11-trienyl] formate |
|---|---|
| PubChem CID | 88702347 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | [(2E,6E)-2,6-dimethyl-10-methylidenedodeca-2,6,11-trienyl] formate |
| SMILES | C=CC(=C)CC/C=C(\C)CC/C=C(\C)COC=O |
| InChI | InChI=1S/C16H24O2/c1-5-14(2)8-6-9-15(3)10-7-11-16(4)12-18-13-17/h5,9,11,13H,1-2,6-8,10,12H2,3-4H3/b15-9+,16-11+ |
| InChIKey | MYUFBJKUKFVCAP-XGGJEREUSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|