C16H26N2S — CID 88702694
6-(2λ4-thia-3-azabicyclo[4.4.0]deca-1,5,7,9-tetraen-2-yl)-N,N-dimethylhexan-1-amine (PubChem CID 88702694) has the molecular formula C16H26N2S and a molecular weight of 278.46 g/mol. Its IUPAC name is 6-(2λ4-thia-3-azabicyclo[4.4.0]deca-1,5,7,9-tetraen-2-yl)-N,N-dimethylhexan-1-amine.
| Compound Name | 6-(2λ4-thia-3-azabicyclo[4.4.0]deca-1,5,7,9-tetraen-2-yl)-N,N-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 88702694 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 6-(2λ4-thia-3-azabicyclo[4.4.0]deca-1,5,7,9-tetraen-2-yl)-N,N-dimethylhexan-1-amine |
| SMILES | CN(C)CCCCCCS1=c2ccccc2=CCN1 |
| InChI | InChI=1S/C16H26N2S/c1-18(2)13-7-3-4-8-14-19-16-10-6-5-9-15(16)11-12-17-19/h5-6,9-11,17H,3-4,7-8,12-14H2,1-2H3 |
| InChIKey | SBUUBTXUZRESCH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|