C11H17NO2 — CID 88702995
3-hydroxyimino-2,5,6,6-tetramethylcyclohexene-1-carbaldehyde (PubChem CID 88702995) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 3-hydroxyimino-2,5,6,6-tetramethylcyclohexene-1-carbaldehyde.
| Compound Name | 3-hydroxyimino-2,5,6,6-tetramethylcyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 88702995 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3-hydroxyimino-2,5,6,6-tetramethylcyclohexene-1-carbaldehyde |
| SMILES | CC1=C(C=O)C(C)(C)C(C)CC1=NO |
| InChI | InChI=1S/C11H17NO2/c1-7-5-10(12-14)8(2)9(6-13)11(7,3)4/h6-7,14H,5H2,1-4H3 |
| InChIKey | GIQYWTQHIJHPTC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|