C15H17NO5 — CID 88703132
5-(oxiran-2-ylmethoxy)-3,4-bis(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-amine (PubChem CID 88703132) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 5-(oxiran-2-ylmethoxy)-3,4-bis(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-amine.
| Compound Name | 5-(oxiran-2-ylmethoxy)-3,4-bis(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 88703132 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 5-(oxiran-2-ylmethoxy)-3,4-bis(oxiran-2-ylmethyl)-7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-amine |
| SMILES | Nc1c(CC2CO2)c(CC2CO2)c(OCC2CO2)c2c1O2 |
| InChI | InChI=1S/C15H17NO5/c16-12-10(1-7-3-17-7)11(2-8-4-18-8)13(15-14(12)21-15)20-6-9-5-19-9/h7-9H,1-6,16H2 |
| InChIKey | ZBTLHIMZTLVBHH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|