C24H29NO2S — CID 88703998
N-(hydroxymethyl)-2-[(1E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxamide (PubChem CID 88703998) has the molecular formula C24H29NO2S and a molecular weight of 395.57 g/mol. Its IUPAC name is N-(hydroxymethyl)-2-[(1E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxamide.
| Compound Name | N-(hydroxymethyl)-2-[(1E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxamide |
|---|---|
| PubChem CID | 88703998 |
| Molecular Formula | C24H29NO2S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-(hydroxymethyl)-2-[(1E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-1-benzothiophene-6-carboxamide |
| SMILES | CC1=C(C=C/C(C)=C/c2cc3ccc(C(=O)NCO)cc3s2)C(C)(C)CCC1 |
| InChI | InChI=1S/C24H29NO2S/c1-16(7-10-21-17(2)6-5-11-24(21,3)4)12-20-13-18-8-9-19(14-22(18)28-20)23(27)25-15-26/h7-10,12-14,26H,5-6,11,15H2,1-4H3,(H,25,27)/b10-7?,16-12+ |
| InChIKey | FDTHWWZDHYQNOL-WZXFQZDVSA-N |
| XLogP | 6.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|