C26H43N3O4 — CID 88704220
3-butyl-1,3,5-oxadiazinane-2,4,6-trione;5-(2-butylphenyl)nonan-5-amine (PubChem CID 88704220) has the molecular formula C26H43N3O4 and a molecular weight of 461.65 g/mol. Its IUPAC name is 3-butyl-1,3,5-oxadiazinane-2,4,6-trione;5-(2-butylphenyl)nonan-5-amine.
| Compound Name | 3-butyl-1,3,5-oxadiazinane-2,4,6-trione;5-(2-butylphenyl)nonan-5-amine |
|---|---|
| PubChem CID | 88704220 |
| Molecular Formula | C26H43N3O4 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.33 |
| IUPAC Name | 3-butyl-1,3,5-oxadiazinane-2,4,6-trione;5-(2-butylphenyl)nonan-5-amine |
| SMILES | CCCCc1ccccc1C(N)(CCCC)CCCC.CCCCn1c(=O)[nH]c(=O)oc1=O |
| InChI | InChI=1S/C19H33N.C7H10N2O4/c1-4-7-12-17-13-10-11-14-18(17)19(20,15-8-5-2)16-9-6-3;1-2-3-4-9-5(10)8-6(11)13-7(9)12/h10-11,13-14H,4-9,12,15-16,20H2,1-3H3;2-4H2,1H3,(H,8,10,11) |
| InChIKey | VBCAEXBTPQPIAG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |