C37H52O8S2 — CID 88704519
2-(2-carboxyethylsulfanylmethylsulfanylmethyl)-4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl]butanoic acid (PubChem CID 88704519) has the molecular formula C37H52O8S2 and a molecular weight of 688.95 g/mol. Its IUPAC name is 2-(2-carboxyethylsulfanylmethylsulfanylmethyl)-4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl]butanoic acid.
| Compound Name | 2-(2-carboxyethylsulfanylmethylsulfanylmethyl)-4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl]butanoic acid |
|---|---|
| PubChem CID | 88704519 |
| Molecular Formula | C37H52O8S2 |
| Molecular Weight | 688.95 g/mol |
| Exact Mass | 688.31 |
| IUPAC Name | 2-(2-carboxyethylsulfanylmethylsulfanylmethyl)-4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl]butanoic acid |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCC(CCC1(C)CCc3c(C)c(O)c(C)c(C)c3O1)(CSCSCCC(=O)O)C(=O)O)O2 |
| InChI | InChI=1S/C37H52O8S2/c1-21-23(3)32-27(25(5)30(21)40)9-12-35(7,44-32)14-16-37(34(42)43,19-47-20-46-18-11-29(38)39)17-15-36(8)13-10-28-26(6)31(41)22(2)24(4)33(28)45-36/h40-41H,9-20H2,1-8H3,(H,38,39)(H,42,43) |
| InChIKey | YGKIKOUFTZWEIH-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.95 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|