C11H14Cl3NO6S — CID 88705159
2-[(2R,3R)-2-ethoxycarbothioyloxy-4-oxoazetidin-3-yl]ethyl 2,2,2-trichloroethyl carbonate (PubChem CID 88705159) has the molecular formula C11H14Cl3NO6S and a molecular weight of 394.66 g/mol. Its IUPAC name is 2-[(2R,3R)-2-ethoxycarbothioyloxy-4-oxoazetidin-3-yl]ethyl 2,2,2-trichloroethyl carbonate.
| Compound Name | 2-[(2R,3R)-2-ethoxycarbothioyloxy-4-oxoazetidin-3-yl]ethyl 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 88705159 |
| Molecular Formula | C11H14Cl3NO6S |
| Molecular Weight | 394.66 g/mol |
| Exact Mass | 392.96 |
| IUPAC Name | 2-[(2R,3R)-2-ethoxycarbothioyloxy-4-oxoazetidin-3-yl]ethyl 2,2,2-trichloroethyl carbonate |
| SMILES | CCOC(=S)O[C@H]1NC(=O)[C@@H]1CCOC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H14Cl3NO6S/c1-2-18-10(22)21-8-6(7(16)15-8)3-4-19-9(17)20-5-11(12,13)14/h6,8H,2-5H2,1H3,(H,15,16)/t6-,8+/m0/s1 |
| InChIKey | LUOSEVINERCIQV-POYBYMJQSA-N |
| XLogP | 2.31 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.66 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|