About 8-[2,5-bis(prop-2-ynoxy)phenyl]-7H-purine
8-[2,5-bis(prop-2-ynoxy)phenyl]-7H-purine (PubChem CID 88705211) has the molecular formula C17H12N4O2
and a molecular weight of 304.31 g/mol. Its IUPAC name is 8-[2,5-bis(prop-2-ynoxy)phenyl]-7H-purine.
Molecular Properties
| Compound Name | 8-[2,5-bis(prop-2-ynoxy)phenyl]-7H-purine |
| PubChem CID | 88705211 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 8-[2,5-bis(prop-2-ynoxy)phenyl]-7H-purine |
| SMILES | C#CCOc1ccc(OCC#C)c(-c2nc3ncncc3[nH]2)c1 |
| InChI | InChI=1S/C17H12N4O2/c1-3-7-22-12-5-6-15(23-8-4-2)13(9-12)16-20-14-10-18-11-19-17(14)21-16/h1-2,5-6,9-11H,7-8H2,(H,18,19,20,21) |
| InChIKey | RBMHQRGXBZFYFY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-[2,5-bis(prop-2-ynoxy)phenyl]-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[2,5-bis(prop-2-ynoxy)phenyl]-7H-purine?
The IUPAC name of 8-[2,5-bis(prop-2-ynoxy)phenyl]-7H-purine (CID 88705211) is 8-[2,5-bis(prop-2-ynoxy)phenyl]-7H-purine.
What is the SMILES notation for 8-[2,5-bis(prop-2-ynoxy)phenyl]-7H-purine?
The canonical SMILES for 8-[2,5-bis(prop-2-ynoxy)phenyl]-7H-purine is C#CCOc1ccc(OCC#C)c(-c2nc3ncncc3[nH]2)c1.
What is the InChIKey of 8-[2,5-bis(prop-2-ynoxy)phenyl]-7H-purine?
The InChIKey is RBMHQRGXBZFYFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N4O2/c1-3-7-22-12-5-6-15(23-8-4-2)13(9-12)16-20-14-10-18-11-19-17(14)21-16/h1-2,5-6,9-11H,7-8H2,(H,18,19,20,21).
What are the key properties of 8-[2,5-bis(prop-2-ynoxy)phenyl]-7H-purine?
8-[2,5-bis(prop-2-ynoxy)phenyl]-7H-purine has a molecular weight of 304.31 g/mol, XLogP of 2.04, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[2,5-bis(prop-2-ynoxy)phenyl]-7H-purine is sourced from PubChem (CID 88705211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).