C40H44N12NaO10S2 — CID 88705482
CID 88705482 (PubChem CID 88705482) has the molecular formula C40H44N12NaO10S2 and a molecular weight of 939.99 g/mol.
| Compound Name | CID 88705482 |
|---|---|
| PubChem CID | 88705482 |
| Molecular Formula | C40H44N12NaO10S2 |
| Molecular Weight | 939.99 g/mol |
| Exact Mass | 939.26 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cc(Nc2nc(Nc3ccccc3)nc(N(CCO)CCO)n2)ccc1/C=C/c1ccc(Nc2nc(Nc3ccccc3)nc(N(CCO)CCO)n2)cc1S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C40H44N12O10S2.Na/c53-21-17-51(18-22-54)39-47-35(41-29-7-3-1-4-8-29)45-37(49-39)43-31-15-13-27(33(25-31)63(57,58)59)11-12-28-14-16-32(26-34(28)64(60,61)62)44-38-46-36(42-30-9-5-2-6-10-30)48-40(50-38)52(19-23-55)20-24-56;/h1-16,25-26,53-56H,17-24H2,(H,57,58,59)(H,60,61,62)(H2,41,43,45,47,49)(H2,42,44,46,48,50);/b12-11+; |
| InChIKey | HNAYZHWQWOMYRN-CALJPSDSSA-N |
| XLogP | 2.90 |
| TPSA | 321.60 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.99 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|