C29H30N2O2 — CID 88705647
naphthalen-2-yl 5-[(1E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]pyrimidine-2-carboxylate (PubChem CID 88705647) has the molecular formula C29H30N2O2 and a molecular weight of 438.57 g/mol. Its IUPAC name is naphthalen-2-yl 5-[(1E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]pyrimidine-2-carboxylate.
| Compound Name | naphthalen-2-yl 5-[(1E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 88705647 |
| Molecular Formula | C29H30N2O2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | naphthalen-2-yl 5-[(1E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]pyrimidine-2-carboxylate |
| SMILES | CC1=C(C=C/C(C)=C/c2cnc(C(=O)Oc3ccc4ccccc4c3)nc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C29H30N2O2/c1-20(11-14-26-21(2)8-7-15-29(26,3)4)16-22-18-30-27(31-19-22)28(32)33-25-13-12-23-9-5-6-10-24(23)17-25/h5-6,9-14,16-19H,7-8,15H2,1-4H3/b14-11?,20-16+ |
| InChIKey | UTFAATHVPNTEPA-VOAQWIGXSA-N |
| XLogP | 7.34 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|