About 2-(but-3-yn-2-ylamino)-N,N-dimethyl-1,3-thiazole-4-carboxamide
2-(but-3-yn-2-ylamino)-N,N-dimethyl-1,3-thiazole-4-carboxamide (PubChem CID 88705798) has the molecular formula C10H13N3OS
and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-(but-3-yn-2-ylamino)-N,N-dimethyl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(but-3-yn-2-ylamino)-N,N-dimethyl-1,3-thiazole-4-carboxamide |
| PubChem CID | 88705798 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-(but-3-yn-2-ylamino)-N,N-dimethyl-1,3-thiazole-4-carboxamide |
| SMILES | C#CC(C)Nc1nc(C(=O)N(C)C)cs1 |
| InChI | InChI=1S/C10H13N3OS/c1-5-7(2)11-10-12-8(6-15-10)9(14)13(3)4/h1,6-7H,2-4H3,(H,11,12) |
| InChIKey | FDDAFKUPHAZLRZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(but-3-yn-2-ylamino)-N,N-dimethyl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(but-3-yn-2-ylamino)-N,N-dimethyl-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(but-3-yn-2-ylamino)-N,N-dimethyl-1,3-thiazole-4-carboxamide (CID 88705798) is 2-(but-3-yn-2-ylamino)-N,N-dimethyl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(but-3-yn-2-ylamino)-N,N-dimethyl-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(but-3-yn-2-ylamino)-N,N-dimethyl-1,3-thiazole-4-carboxamide is C#CC(C)Nc1nc(C(=O)N(C)C)cs1.
What is the InChIKey of 2-(but-3-yn-2-ylamino)-N,N-dimethyl-1,3-thiazole-4-carboxamide?
The InChIKey is FDDAFKUPHAZLRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3OS/c1-5-7(2)11-10-12-8(6-15-10)9(14)13(3)4/h1,6-7H,2-4H3,(H,11,12).
What are the key properties of 2-(but-3-yn-2-ylamino)-N,N-dimethyl-1,3-thiazole-4-carboxamide?
2-(but-3-yn-2-ylamino)-N,N-dimethyl-1,3-thiazole-4-carboxamide has a molecular weight of 223.30 g/mol, XLogP of 1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(but-3-yn-2-ylamino)-N,N-dimethyl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 88705798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).