About [2-oxo-2-[prop-2-enyl(2,2,2-trifluoroethyl)amino]ethyl] acetate
[2-oxo-2-[prop-2-enyl(2,2,2-trifluoroethyl)amino]ethyl] acetate (PubChem CID 88706113) has the molecular formula C9H12F3NO3
and a molecular weight of 239.19 g/mol. Its IUPAC name is [2-oxo-2-[prop-2-enyl(2,2,2-trifluoroethyl)amino]ethyl] acetate.
Molecular Properties
| Compound Name | [2-oxo-2-[prop-2-enyl(2,2,2-trifluoroethyl)amino]ethyl] acetate |
| PubChem CID | 88706113 |
| Molecular Formula | C9H12F3NO3 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | [2-oxo-2-[prop-2-enyl(2,2,2-trifluoroethyl)amino]ethyl] acetate |
| SMILES | C=CCN(CC(F)(F)F)C(=O)COC(C)=O |
| InChI | InChI=1S/C9H12F3NO3/c1-3-4-13(6-9(10,11)12)8(15)5-16-7(2)14/h3H,1,4-6H2,2H3 |
| InChIKey | JVRSGJCTFMPLFE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-[prop-2-enyl(2,2,2-trifluoroethyl)amino]ethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[prop-2-enyl(2,2,2-trifluoroethyl)amino]ethyl] acetate?
The IUPAC name of [2-oxo-2-[prop-2-enyl(2,2,2-trifluoroethyl)amino]ethyl] acetate (CID 88706113) is [2-oxo-2-[prop-2-enyl(2,2,2-trifluoroethyl)amino]ethyl] acetate.
What is the SMILES notation for [2-oxo-2-[prop-2-enyl(2,2,2-trifluoroethyl)amino]ethyl] acetate?
The canonical SMILES for [2-oxo-2-[prop-2-enyl(2,2,2-trifluoroethyl)amino]ethyl] acetate is C=CCN(CC(F)(F)F)C(=O)COC(C)=O.
What is the InChIKey of [2-oxo-2-[prop-2-enyl(2,2,2-trifluoroethyl)amino]ethyl] acetate?
The InChIKey is JVRSGJCTFMPLFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NO3/c1-3-4-13(6-9(10,11)12)8(15)5-16-7(2)14/h3H,1,4-6H2,2H3.
What are the key properties of [2-oxo-2-[prop-2-enyl(2,2,2-trifluoroethyl)amino]ethyl] acetate?
[2-oxo-2-[prop-2-enyl(2,2,2-trifluoroethyl)amino]ethyl] acetate has a molecular weight of 239.19 g/mol, XLogP of 1.13, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[prop-2-enyl(2,2,2-trifluoroethyl)amino]ethyl] acetate is sourced from PubChem (CID 88706113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).