About 1,2-dichlorobenzene;6-(4-sulfinylbutoxy)-1H-quinolin-2-one
1,2-dichlorobenzene;6-(4-sulfinylbutoxy)-1H-quinolin-2-one (PubChem CID 88706822) has the molecular formula C19H17Cl2NO3S
and a molecular weight of 410.32 g/mol. Its IUPAC name is 1,2-dichlorobenzene;6-(4-sulfinylbutoxy)-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 1,2-dichlorobenzene;6-(4-sulfinylbutoxy)-1H-quinolin-2-one |
| PubChem CID | 88706822 |
| Molecular Formula | C19H17Cl2NO3S |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 1,2-dichlorobenzene;6-(4-sulfinylbutoxy)-1H-quinolin-2-one |
| SMILES | Clc1ccccc1Cl.O=S=CCCCOc1ccc2[nH]c(=O)ccc2c1 |
| InChI | InChI=1S/C13H13NO3S.C6H4Cl2/c15-13-6-3-10-9-11(4-5-12(10)14-13)17-7-1-2-8-18-16;7-5-3-1-2-4-6(5)8/h3-6,8-9H,1-2,7H2,(H,14,15);1-4H |
| InChIKey | CVLGGMZMKCTHRA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichlorobenzene;6-(4-sulfinylbutoxy)-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichlorobenzene;6-(4-sulfinylbutoxy)-1H-quinolin-2-one?
The IUPAC name of 1,2-dichlorobenzene;6-(4-sulfinylbutoxy)-1H-quinolin-2-one (CID 88706822) is 1,2-dichlorobenzene;6-(4-sulfinylbutoxy)-1H-quinolin-2-one.
What is the SMILES notation for 1,2-dichlorobenzene;6-(4-sulfinylbutoxy)-1H-quinolin-2-one?
The canonical SMILES for 1,2-dichlorobenzene;6-(4-sulfinylbutoxy)-1H-quinolin-2-one is Clc1ccccc1Cl.O=S=CCCCOc1ccc2[nH]c(=O)ccc2c1.
What is the InChIKey of 1,2-dichlorobenzene;6-(4-sulfinylbutoxy)-1H-quinolin-2-one?
The InChIKey is CVLGGMZMKCTHRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S.C6H4Cl2/c15-13-6-3-10-9-11(4-5-12(10)14-13)17-7-1-2-8-18-16;7-5-3-1-2-4-6(5)8/h3-6,8-9H,1-2,7H2,(H,14,15);1-4H.
What are the key properties of 1,2-dichlorobenzene;6-(4-sulfinylbutoxy)-1H-quinolin-2-one?
1,2-dichlorobenzene;6-(4-sulfinylbutoxy)-1H-quinolin-2-one has a molecular weight of 410.32 g/mol, XLogP of 4.70, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichlorobenzene;6-(4-sulfinylbutoxy)-1H-quinolin-2-one is sourced from PubChem (CID 88706822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).