C12H17N5 — CID 88706912
2-amino-2,3,4,4a,5,5a,7,8-octahydro-1H-pyrido[2,3-g]quinazoline-6-carbonitrile (PubChem CID 88706912) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-amino-2,3,4,4a,5,5a,7,8-octahydro-1H-pyrido[2,3-g]quinazoline-6-carbonitrile.
| Compound Name | 2-amino-2,3,4,4a,5,5a,7,8-octahydro-1H-pyrido[2,3-g]quinazoline-6-carbonitrile |
|---|---|
| PubChem CID | 88706912 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 2-amino-2,3,4,4a,5,5a,7,8-octahydro-1H-pyrido[2,3-g]quinazoline-6-carbonitrile |
| SMILES | N#CN1CCC=C2C=C3NC(N)NCC3CC21 |
| InChI | InChI=1S/C12H17N5/c13-7-17-3-1-2-8-4-10-9(5-11(8)17)6-15-12(14)16-10/h2,4,9,11-12,15-16H,1,3,5-6,14H2 |
| InChIKey | JAZZPLVMBMSWSG-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|