About 3-cyclohexyl-1-[dichloro(fluoromethyl)-λ4-sulfanyl]imidazolidine-2,4-dione
3-cyclohexyl-1-[dichloro(fluoromethyl)-λ4-sulfanyl]imidazolidine-2,4-dione (PubChem CID 88706948) has the molecular formula C10H15Cl2FN2O2S
and a molecular weight of 317.21 g/mol. Its IUPAC name is 3-cyclohexyl-1-[dichloro(fluoromethyl)-λ4-sulfanyl]imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-cyclohexyl-1-[dichloro(fluoromethyl)-λ4-sulfanyl]imidazolidine-2,4-dione |
| PubChem CID | 88706948 |
| Molecular Formula | C10H15Cl2FN2O2S |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 3-cyclohexyl-1-[dichloro(fluoromethyl)-λ4-sulfanyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(S(Cl)(Cl)CF)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C10H15Cl2FN2O2S/c11-18(12,7-13)14-6-9(16)15(10(14)17)8-4-2-1-3-5-8/h8H,1-7H2 |
| InChIKey | AOQHSZXWPOSAJA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexyl-1-[dichloro(fluoromethyl)-λ4-sulfanyl]imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1-[dichloro(fluoromethyl)-λ4-sulfanyl]imidazolidine-2,4-dione?
The IUPAC name of 3-cyclohexyl-1-[dichloro(fluoromethyl)-λ4-sulfanyl]imidazolidine-2,4-dione (CID 88706948) is 3-cyclohexyl-1-[dichloro(fluoromethyl)-λ4-sulfanyl]imidazolidine-2,4-dione.
What is the SMILES notation for 3-cyclohexyl-1-[dichloro(fluoromethyl)-λ4-sulfanyl]imidazolidine-2,4-dione?
The canonical SMILES for 3-cyclohexyl-1-[dichloro(fluoromethyl)-λ4-sulfanyl]imidazolidine-2,4-dione is O=C1CN(S(Cl)(Cl)CF)C(=O)N1C1CCCCC1.
What is the InChIKey of 3-cyclohexyl-1-[dichloro(fluoromethyl)-λ4-sulfanyl]imidazolidine-2,4-dione?
The InChIKey is AOQHSZXWPOSAJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15Cl2FN2O2S/c11-18(12,7-13)14-6-9(16)15(10(14)17)8-4-2-1-3-5-8/h8H,1-7H2.
What are the key properties of 3-cyclohexyl-1-[dichloro(fluoromethyl)-λ4-sulfanyl]imidazolidine-2,4-dione?
3-cyclohexyl-1-[dichloro(fluoromethyl)-λ4-sulfanyl]imidazolidine-2,4-dione has a molecular weight of 317.21 g/mol, XLogP of 3.54, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1-[dichloro(fluoromethyl)-λ4-sulfanyl]imidazolidine-2,4-dione is sourced from PubChem (CID 88706948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).