C23H25ClN4 — CID 88706970
1-[2-[N-(2-chloro-3-pyridinyl)-C-phenylcarbonimidoyl]phenyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 88706970) has the molecular formula C23H25ClN4 and a molecular weight of 392.93 g/mol. Its IUPAC name is 1-[2-[N-(2-chloro-3-pyridinyl)-C-phenylcarbonimidoyl]phenyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | 1-[2-[N-(2-chloro-3-pyridinyl)-C-phenylcarbonimidoyl]phenyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 88706970 |
| Molecular Formula | C23H25ClN4 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-[2-[N-(2-chloro-3-pyridinyl)-C-phenylcarbonimidoyl]phenyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCC(N)c1ccccc1/C(=N/c1cccnc1Cl)c1ccccc1 |
| InChI | InChI=1S/C23H25ClN4/c1-28(2)16-14-20(25)18-11-6-7-12-19(18)22(17-9-4-3-5-10-17)27-21-13-8-15-26-23(21)24/h3-13,15,20H,14,16,25H2,1-2H3/b27-22+ |
| InChIKey | VRAYLQFTKGGVKV-HPNDGRJYSA-N |
| XLogP | 4.86 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|