C29H28N2O5 — CID 88707148
2-[2,6-di(propan-2-yl)phenyl]-N-[6-methoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]-1,3-dioxoisoindole-4-carboxamide (PubChem CID 88707148) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)phenyl]-N-[6-methoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]-1,3-dioxoisoindole-4-carboxamide.
| Compound Name | 2-[2,6-di(propan-2-yl)phenyl]-N-[6-methoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]-1,3-dioxoisoindole-4-carboxamide |
|---|---|
| PubChem CID | 88707148 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)phenyl]-N-[6-methoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]-1,3-dioxoisoindole-4-carboxamide |
| SMILES | COC1C(=C=O)C=CC=C1NC(=O)c1cccc2c1C(=O)N(c1c(C(C)C)cccc1C(C)C)C2=O |
| InChI | InChI=1S/C29H28N2O5/c1-16(2)19-10-7-11-20(17(3)4)25(19)31-28(34)22-13-8-12-21(24(22)29(31)35)27(33)30-23-14-6-9-18(15-32)26(23)36-5/h6-14,16-17,26H,1-5H3,(H,30,33) |
| InChIKey | DXEHQFFKVKLTST-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|