C13H19F3N4O4S — CID 88707253
ethyl 3-hydroxy-5-[3-[sulfanyl(2,2,2-trifluoroethylcarbamoyl)amino]pyrazol-1-yl]pentanoate (PubChem CID 88707253) has the molecular formula C13H19F3N4O4S and a molecular weight of 384.38 g/mol. Its IUPAC name is ethyl 3-hydroxy-5-[3-[sulfanyl(2,2,2-trifluoroethylcarbamoyl)amino]pyrazol-1-yl]pentanoate.
| Compound Name | ethyl 3-hydroxy-5-[3-[sulfanyl(2,2,2-trifluoroethylcarbamoyl)amino]pyrazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 88707253 |
| Molecular Formula | C13H19F3N4O4S |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | ethyl 3-hydroxy-5-[3-[sulfanyl(2,2,2-trifluoroethylcarbamoyl)amino]pyrazol-1-yl]pentanoate |
| SMILES | CCOC(=O)CC(O)CCn1ccc(N(S)C(=O)NCC(F)(F)F)n1 |
| InChI | InChI=1S/C13H19F3N4O4S/c1-2-24-11(22)7-9(21)3-5-19-6-4-10(18-19)20(25)12(23)17-8-13(14,15)16/h4,6,9,21,25H,2-3,5,7-8H2,1H3,(H,17,23) |
| InChIKey | CGAUELOEAZQDTE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|