C21H52O6Si5 — CID 88707263
(2S,3R,4R,5R)-4,5,6-trihydroxy-1,2,3-tris(trimethylsilyl)-2,3-bis(trimethylsilyloxy)hexan-1-one (PubChem CID 88707263) has the molecular formula C21H52O6Si5 and a molecular weight of 541.07 g/mol. Its IUPAC name is (2S,3R,4R,5R)-4,5,6-trihydroxy-1,2,3-tris(trimethylsilyl)-2,3-bis(trimethylsilyloxy)hexan-1-one.
| Compound Name | (2S,3R,4R,5R)-4,5,6-trihydroxy-1,2,3-tris(trimethylsilyl)-2,3-bis(trimethylsilyloxy)hexan-1-one |
|---|---|
| PubChem CID | 88707263 |
| Molecular Formula | C21H52O6Si5 |
| Molecular Weight | 541.07 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | (2S,3R,4R,5R)-4,5,6-trihydroxy-1,2,3-tris(trimethylsilyl)-2,3-bis(trimethylsilyloxy)hexan-1-one |
| SMILES | C[Si](C)(C)O[C@@](C(=O)[Si](C)(C)C)([C@@](O[Si](C)(C)C)([C@H](O)[C@H](O)CO)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C21H52O6Si5/c1-28(2,3)19(25)21(30(7,8)9,27-32(13,14)15)20(29(4,5)6,26-31(10,11)12)18(24)17(23)16-22/h17-18,22-24H,16H2,1-15H3/t17-,18-,20-,21-/m1/s1 |
| InChIKey | XMWBEFNVBRHGIA-VURPSTOHSA-N |
| XLogP | 4.08 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.07 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|