C11H14Cl3N5OS — CID 88707398
1-[3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]-1-methyl-3-sulfanylurea;hydrochloride (PubChem CID 88707398) has the molecular formula C11H14Cl3N5OS and a molecular weight of 370.69 g/mol. Its IUPAC name is 1-[3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]-1-methyl-3-sulfanylurea;hydrochloride.
| Compound Name | 1-[3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]-1-methyl-3-sulfanylurea;hydrochloride |
|---|---|
| PubChem CID | 88707398 |
| Molecular Formula | C11H14Cl3N5OS |
| Molecular Weight | 370.69 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 1-[3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]-1-methyl-3-sulfanylurea;hydrochloride |
| SMILES | CN(C(=O)NS)c1cc(Cl)c(NC2=NCCN2)c(Cl)c1.Cl |
| InChI | InChI=1S/C11H13Cl2N5OS.ClH/c1-18(11(19)17-20)6-4-7(12)9(8(13)5-6)16-10-14-2-3-15-10;/h4-5,20H,2-3H2,1H3,(H,17,19)(H2,14,15,16);1H |
| InChIKey | JKJRSCMLVGMILC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|