About carbamic acid;1-[(3-methyl-2H-1,3-benzothiazol-2-yl)sulfanyl]propan-2-imine
carbamic acid;1-[(3-methyl-2H-1,3-benzothiazol-2-yl)sulfanyl]propan-2-imine (PubChem CID 88707465) has the molecular formula C13H20N4O4S2
and a molecular weight of 360.46 g/mol. Its IUPAC name is carbamic acid;1-[(3-methyl-2H-1,3-benzothiazol-2-yl)sulfanyl]propan-2-imine.
Molecular Properties
| Compound Name | carbamic acid;1-[(3-methyl-2H-1,3-benzothiazol-2-yl)sulfanyl]propan-2-imine |
| PubChem CID | 88707465 |
| Molecular Formula | C13H20N4O4S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | carbamic acid;1-[(3-methyl-2H-1,3-benzothiazol-2-yl)sulfanyl]propan-2-imine |
| SMILES | NC(=O)O.NC(=O)O.[H]/N=C(\C)CSC1Sc2ccccc2N1C |
| InChI | InChI=1S/C11H14N2S2.2CH3NO2/c1-8(12)7-14-11-13(2)9-5-3-4-6-10(9)15-11;2*2-1(3)4/h3-6,11-12H,7H2,1-2H3;2*2H2,(H,3,4)/b12-8+;; |
| InChIKey | XUIAMCOOJARLPO-BPWZRWDXSA-N |
| XLogP | 2.53 |
| TPSA | 153.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;1-[(3-methyl-2H-1,3-benzothiazol-2-yl)sulfanyl]propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;1-[(3-methyl-2H-1,3-benzothiazol-2-yl)sulfanyl]propan-2-imine?
The IUPAC name of carbamic acid;1-[(3-methyl-2H-1,3-benzothiazol-2-yl)sulfanyl]propan-2-imine (CID 88707465) is carbamic acid;1-[(3-methyl-2H-1,3-benzothiazol-2-yl)sulfanyl]propan-2-imine.
What is the SMILES notation for carbamic acid;1-[(3-methyl-2H-1,3-benzothiazol-2-yl)sulfanyl]propan-2-imine?
The canonical SMILES for carbamic acid;1-[(3-methyl-2H-1,3-benzothiazol-2-yl)sulfanyl]propan-2-imine is NC(=O)O.NC(=O)O.[H]/N=C(\C)CSC1Sc2ccccc2N1C.
What is the InChIKey of carbamic acid;1-[(3-methyl-2H-1,3-benzothiazol-2-yl)sulfanyl]propan-2-imine?
The InChIKey is XUIAMCOOJARLPO-BPWZRWDXSA-N. The full InChI is InChI=1S/C11H14N2S2.2CH3NO2/c1-8(12)7-14-11-13(2)9-5-3-4-6-10(9)15-11;2*2-1(3)4/h3-6,11-12H,7H2,1-2H3;2*2H2,(H,3,4)/b12-8+;;.
What are the key properties of carbamic acid;1-[(3-methyl-2H-1,3-benzothiazol-2-yl)sulfanyl]propan-2-imine?
carbamic acid;1-[(3-methyl-2H-1,3-benzothiazol-2-yl)sulfanyl]propan-2-imine has a molecular weight of 360.46 g/mol, XLogP of 2.53, 3 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;1-[(3-methyl-2H-1,3-benzothiazol-2-yl)sulfanyl]propan-2-imine is sourced from PubChem (CID 88707465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).