About potassium;benzotriazole-3a-carboxylate;silver
potassium;benzotriazole-3a-carboxylate;silver (PubChem CID 88707530) has the molecular formula C7H4AgKN3O2
and a molecular weight of 309.09 g/mol. Its IUPAC name is potassium;benzotriazole-3a-carboxylate;silver.
Molecular Properties
| Compound Name | potassium;benzotriazole-3a-carboxylate;silver |
| PubChem CID | 88707530 |
| Molecular Formula | C7H4AgKN3O2 |
| Molecular Weight | 309.09 g/mol |
| Exact Mass | 307.90 |
| IUPAC Name | potassium;benzotriazole-3a-carboxylate;silver |
| SMILES | O=C([O-])C12C=CC=CC1=NN=N2.[Ag].[K+] |
| InChI | InChI=1S/C7H5N3O2.Ag.K/c11-6(12)7-4-2-1-3-5(7)8-10-9-7;;/h1-4H,(H,11,12);;/q;;+1/p-1 |
| InChIKey | DNHVNIFJSFVWBN-UHFFFAOYSA-M |
| XLogP | -3.58 |
| TPSA | 77.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.09 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze potassium;benzotriazole-3a-carboxylate;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;benzotriazole-3a-carboxylate;silver?
The IUPAC name of potassium;benzotriazole-3a-carboxylate;silver (CID 88707530) is potassium;benzotriazole-3a-carboxylate;silver.
What is the SMILES notation for potassium;benzotriazole-3a-carboxylate;silver?
The canonical SMILES for potassium;benzotriazole-3a-carboxylate;silver is O=C([O-])C12C=CC=CC1=NN=N2.[Ag].[K+].
What is the InChIKey of potassium;benzotriazole-3a-carboxylate;silver?
The InChIKey is DNHVNIFJSFVWBN-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5N3O2.Ag.K/c11-6(12)7-4-2-1-3-5(7)8-10-9-7;;/h1-4H,(H,11,12);;/q;;+1/p-1.
What are the key properties of potassium;benzotriazole-3a-carboxylate;silver?
potassium;benzotriazole-3a-carboxylate;silver has a molecular weight of 309.09 g/mol, XLogP of -3.58, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;benzotriazole-3a-carboxylate;silver is sourced from PubChem (CID 88707530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).