C17H16Cl2FN5S — CID 88708118
1-[3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]-1-[(4-fluorophenyl)methyl]thiourea (PubChem CID 88708118) has the molecular formula C17H16Cl2FN5S and a molecular weight of 412.32 g/mol. Its IUPAC name is 1-[3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]-1-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-[3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]-1-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 88708118 |
| Molecular Formula | C17H16Cl2FN5S |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 1-[3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]-1-[(4-fluorophenyl)methyl]thiourea |
| SMILES | NC(=S)N(Cc1ccc(F)cc1)c1cc(Cl)c(NC2=NCCN2)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2FN5S/c18-13-7-12(8-14(19)15(13)24-17-22-5-6-23-17)25(16(21)26)9-10-1-3-11(20)4-2-10/h1-4,7-8H,5-6,9H2,(H2,21,26)(H2,22,23,24) |
| InChIKey | VZSOSEHRBFYMCG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|