C18H20N2O3S2 — CID 88708138
3-(5-cyano-1,3-benzothiazol-2-yl)-4-oxo-2,2-di(propan-2-yl)-4-sulfanylbutanoic acid (PubChem CID 88708138) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-(5-cyano-1,3-benzothiazol-2-yl)-4-oxo-2,2-di(propan-2-yl)-4-sulfanylbutanoic acid.
| Compound Name | 3-(5-cyano-1,3-benzothiazol-2-yl)-4-oxo-2,2-di(propan-2-yl)-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 88708138 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 3-(5-cyano-1,3-benzothiazol-2-yl)-4-oxo-2,2-di(propan-2-yl)-4-sulfanylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)(C(C)C)C(C(=O)S)c1nc2cc(C#N)ccc2s1 |
| InChI | InChI=1S/C18H20N2O3S2/c1-9(2)18(10(3)4,17(22)23)14(16(21)24)15-20-12-7-11(8-19)5-6-13(12)25-15/h5-7,9-10,14H,1-4H3,(H,21,24)(H,22,23) |
| InChIKey | XKURMNBYJFCLNV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 91.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|