C15H9F9O2 — CID 88708140
difluoro-(2,3,4-trifluorophenyl)methanol;(2,3,5,6-tetrafluoro-4-methylphenyl)methanol (PubChem CID 88708140) has the molecular formula C15H9F9O2 and a molecular weight of 392.22 g/mol. Its IUPAC name is difluoro-(2,3,4-trifluorophenyl)methanol;(2,3,5,6-tetrafluoro-4-methylphenyl)methanol.
| Compound Name | difluoro-(2,3,4-trifluorophenyl)methanol;(2,3,5,6-tetrafluoro-4-methylphenyl)methanol |
|---|---|
| PubChem CID | 88708140 |
| Molecular Formula | C15H9F9O2 |
| Molecular Weight | 392.22 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | difluoro-(2,3,4-trifluorophenyl)methanol;(2,3,5,6-tetrafluoro-4-methylphenyl)methanol |
| SMILES | Cc1c(F)c(F)c(CO)c(F)c1F.OC(F)(F)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C8H6F4O.C7H3F5O/c1-3-5(9)7(11)4(2-13)8(12)6(3)10;8-4-2-1-3(7(11,12)13)5(9)6(4)10/h13H,2H2,1H3;1-2,13H |
| InChIKey | FDETZSHEUKKBNM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|