About 1,6-dihydropyrido[2,3-g]quinazoline
1,6-dihydropyrido[2,3-g]quinazoline (PubChem CID 88708143) has the molecular formula C11H9N3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 1,6-dihydropyrido[2,3-g]quinazoline.
Molecular Properties
| Compound Name | 1,6-dihydropyrido[2,3-g]quinazoline |
| PubChem CID | 88708143 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 1,6-dihydropyrido[2,3-g]quinazoline |
| SMILES | C1=CNc2cc3c(cc2=C1)NC=NC=3 |
| InChI | InChI=1S/C11H9N3/c1-2-8-4-11-9(6-12-7-14-11)5-10(8)13-3-1/h1-7,13H,(H,12,14) |
| InChIKey | WQJQHVUZXIMGAR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,6-dihydropyrido[2,3-g]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dihydropyrido[2,3-g]quinazoline?
The IUPAC name of 1,6-dihydropyrido[2,3-g]quinazoline (CID 88708143) is 1,6-dihydropyrido[2,3-g]quinazoline.
What is the SMILES notation for 1,6-dihydropyrido[2,3-g]quinazoline?
The canonical SMILES for 1,6-dihydropyrido[2,3-g]quinazoline is C1=CNc2cc3c(cc2=C1)NC=NC=3.
What is the InChIKey of 1,6-dihydropyrido[2,3-g]quinazoline?
The InChIKey is WQJQHVUZXIMGAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3/c1-2-8-4-11-9(6-12-7-14-11)5-10(8)13-3-1/h1-7,13H,(H,12,14).
What are the key properties of 1,6-dihydropyrido[2,3-g]quinazoline?
1,6-dihydropyrido[2,3-g]quinazoline has a molecular weight of 183.21 g/mol, XLogP of 0.60, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dihydropyrido[2,3-g]quinazoline is sourced from PubChem (CID 88708143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).