C23H24N2O5 — CID 88708156
[[2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxoisoindole-4-carbonyl]amino] acetate (PubChem CID 88708156) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is [[2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxoisoindole-4-carbonyl]amino] acetate.
| Compound Name | [[2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxoisoindole-4-carbonyl]amino] acetate |
|---|---|
| PubChem CID | 88708156 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [[2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxoisoindole-4-carbonyl]amino] acetate |
| SMILES | CC(=O)ONC(=O)c1cccc2c1C(=O)N(c1c(C(C)C)cccc1C(C)C)C2=O |
| InChI | InChI=1S/C23H24N2O5/c1-12(2)15-8-6-9-16(13(3)4)20(15)25-22(28)18-11-7-10-17(19(18)23(25)29)21(27)24-30-14(5)26/h6-13H,1-5H3,(H,24,27) |
| InChIKey | IZOTZSBBUISLSM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|