About sodium;ethoxyethane;hexyl sulfate
sodium;ethoxyethane;hexyl sulfate (PubChem CID 88708735) has the molecular formula C10H23NaO5S
and a molecular weight of 278.35 g/mol. Its IUPAC name is sodium;ethoxyethane;hexyl sulfate.
Molecular Properties
| Compound Name | sodium;ethoxyethane;hexyl sulfate |
| PubChem CID | 88708735 |
| Molecular Formula | C10H23NaO5S |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | sodium;ethoxyethane;hexyl sulfate |
| SMILES | CCCCCCOS(=O)(=O)[O-].CCOCC.[Na+] |
| InChI | InChI=1S/C6H14O4S.C4H10O.Na/c1-2-3-4-5-6-10-11(7,8)9;1-3-5-4-2;/h2-6H2,1H3,(H,7,8,9);3-4H2,1-2H3;/q;;+1/p-1 |
| InChIKey | AEEAFHFSWOYNQA-UHFFFAOYSA-M |
| XLogP | -0.91 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium;ethoxyethane;hexyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethoxyethane;hexyl sulfate?
The IUPAC name of sodium;ethoxyethane;hexyl sulfate (CID 88708735) is sodium;ethoxyethane;hexyl sulfate.
What is the SMILES notation for sodium;ethoxyethane;hexyl sulfate?
The canonical SMILES for sodium;ethoxyethane;hexyl sulfate is CCCCCCOS(=O)(=O)[O-].CCOCC.[Na+].
What is the InChIKey of sodium;ethoxyethane;hexyl sulfate?
The InChIKey is AEEAFHFSWOYNQA-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H14O4S.C4H10O.Na/c1-2-3-4-5-6-10-11(7,8)9;1-3-5-4-2;/h2-6H2,1H3,(H,7,8,9);3-4H2,1-2H3;/q;;+1/p-1.
What are the key properties of sodium;ethoxyethane;hexyl sulfate?
sodium;ethoxyethane;hexyl sulfate has a molecular weight of 278.35 g/mol, XLogP of -0.91, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethoxyethane;hexyl sulfate is sourced from PubChem (CID 88708735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).