C28H29F5O2 — CID 88709181
11-ethynyl-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1-phenyl-1,2,4,5,6,7,8,9,10,11,12,14-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 88709181) has the molecular formula C28H29F5O2 and a molecular weight of 492.53 g/mol. Its IUPAC name is 11-ethynyl-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1-phenyl-1,2,4,5,6,7,8,9,10,11,12,14-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 11-ethynyl-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1-phenyl-1,2,4,5,6,7,8,9,10,11,12,14-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88709181 |
| Molecular Formula | C28H29F5O2 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 11-ethynyl-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1-phenyl-1,2,4,5,6,7,8,9,10,11,12,14-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C#CC1CC2(C)C(C=CC2(O)C(F)(F)C(F)(F)F)C2CCC3CC(=O)CC(c4ccccc4)C3C12 |
| InChI | InChI=1S/C28H29F5O2/c1-3-16-15-25(2)22(11-12-26(25,35)27(29,30)28(31,32)33)20-10-9-18-13-19(34)14-21(24(18)23(16)20)17-7-5-4-6-8-17/h1,4-8,11-12,16,18,20-24,35H,9-10,13-15H2,2H3 |
| InChIKey | WBZLCILKTWVRND-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|