C14H5Cl5O4 — CID 88709263
2-benzofuran-1,3-dione;2,3,4,5,6-pentachlorophenol (PubChem CID 88709263) has the molecular formula C14H5Cl5O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;2,3,4,5,6-pentachlorophenol.
| Compound Name | 2-benzofuran-1,3-dione;2,3,4,5,6-pentachlorophenol |
|---|---|
| PubChem CID | 88709263 |
| Molecular Formula | C14H5Cl5O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 411.86 |
| IUPAC Name | 2-benzofuran-1,3-dione;2,3,4,5,6-pentachlorophenol |
| SMILES | O=C1OC(=O)c2ccccc21.Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C8H4O3.C6HCl5O/c9-7-5-3-1-2-4-6(5)8(10)11-7;7-1-2(8)4(10)6(12)5(11)3(1)9/h1-4H;12H |
| InChIKey | QIMBVPPYROJLJJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|