About 3-hydroperoxy-1,2,4,5-tetramethylbenzene
3-hydroperoxy-1,2,4,5-tetramethylbenzene (PubChem CID 88709611) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-hydroperoxy-1,2,4,5-tetramethylbenzene.
Molecular Properties
| Compound Name | 3-hydroperoxy-1,2,4,5-tetramethylbenzene |
| PubChem CID | 88709611 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 3-hydroperoxy-1,2,4,5-tetramethylbenzene |
| SMILES | Cc1cc(C)c(C)c(OO)c1C |
| InChI | InChI=1S/C10H14O2/c1-6-5-7(2)9(4)10(12-11)8(6)3/h5,11H,1-4H3 |
| InChIKey | ZVIWERPBGLJGQZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroperoxy-1,2,4,5-tetramethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroperoxy-1,2,4,5-tetramethylbenzene?
The IUPAC name of 3-hydroperoxy-1,2,4,5-tetramethylbenzene (CID 88709611) is 3-hydroperoxy-1,2,4,5-tetramethylbenzene.
What is the SMILES notation for 3-hydroperoxy-1,2,4,5-tetramethylbenzene?
The canonical SMILES for 3-hydroperoxy-1,2,4,5-tetramethylbenzene is Cc1cc(C)c(C)c(OO)c1C.
What is the InChIKey of 3-hydroperoxy-1,2,4,5-tetramethylbenzene?
The InChIKey is ZVIWERPBGLJGQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-6-5-7(2)9(4)10(12-11)8(6)3/h5,11H,1-4H3.
What are the key properties of 3-hydroperoxy-1,2,4,5-tetramethylbenzene?
3-hydroperoxy-1,2,4,5-tetramethylbenzene has a molecular weight of 166.22 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroperoxy-1,2,4,5-tetramethylbenzene is sourced from PubChem (CID 88709611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).