About [tert-butyl-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]boranyl]-phenylphosphane iodide
[tert-butyl-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]boranyl]-phenylphosphane iodide (PubChem CID 88710039) has the molecular formula C23H31BIN2P
and a molecular weight of 504.21 g/mol. Its IUPAC name is [tert-butyl-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]boranyl]-phenylphosphane iodide.
Molecular Properties
| Compound Name | [tert-butyl-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]boranyl]-phenylphosphane iodide |
| PubChem CID | 88710039 |
| Molecular Formula | C23H31BIN2P |
| Molecular Weight | 504.21 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | [tert-butyl-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]boranyl]-phenylphosphane iodide |
| SMILES | Cc1cc(C)c(-n2cc[n+](CB(Pc3ccccc3)C(C)(C)C)c2)c(C)c1.[I-] |
| InChI | InChI=1S/C23H31BN2P.HI/c1-18-14-19(2)22(20(3)15-18)26-13-12-25(17-26)16-24(23(4,5)6)27-21-10-8-7-9-11-21;/h7-15,17,27H,16H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | LFQKDEBUEPMCQF-UHFFFAOYSA-M |
| XLogP | 2.03 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 504.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [tert-butyl-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]boranyl]-phenylphosphane iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tert-butyl-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]boranyl]-phenylphosphane iodide?
The IUPAC name of [tert-butyl-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]boranyl]-phenylphosphane iodide (CID 88710039) is [tert-butyl-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]boranyl]-phenylphosphane iodide.
What is the SMILES notation for [tert-butyl-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]boranyl]-phenylphosphane iodide?
The canonical SMILES for [tert-butyl-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]boranyl]-phenylphosphane iodide is Cc1cc(C)c(-n2cc[n+](CB(Pc3ccccc3)C(C)(C)C)c2)c(C)c1.[I-].
What is the InChIKey of [tert-butyl-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]boranyl]-phenylphosphane iodide?
The InChIKey is LFQKDEBUEPMCQF-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H31BN2P.HI/c1-18-14-19(2)22(20(3)15-18)26-13-12-25(17-26)16-24(23(4,5)6)27-21-10-8-7-9-11-21;/h7-15,17,27H,16H2,1-6H3;1H/q+1;/p-1.
What are the key properties of [tert-butyl-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]boranyl]-phenylphosphane iodide?
[tert-butyl-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]boranyl]-phenylphosphane iodide has a molecular weight of 504.21 g/mol, XLogP of 2.03, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [tert-butyl-[[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]methyl]boranyl]-phenylphosphane iodide is sourced from PubChem (CID 88710039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).