C19H16FN5OS — CID 8871021
N-(2-cyanoethyl)-2-[[4-(4-fluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 8871021) has the molecular formula C19H16FN5OS and a molecular weight of 381.44 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[[4-(4-fluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[[4-(4-fluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 8871021 |
| Molecular Formula | C19H16FN5OS |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-(2-cyanoethyl)-2-[[4-(4-fluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | N#CCCNC(=O)CSc1nnc(-c2ccccc2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16FN5OS/c20-15-7-9-16(10-8-15)25-18(14-5-2-1-3-6-14)23-24-19(25)27-13-17(26)22-12-4-11-21/h1-3,5-10H,4,12-13H2,(H,22,26) |
| InChIKey | UMJIRJKLLQLVTM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|