About 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;hydrochloride
2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;hydrochloride (PubChem CID 88710434) has the molecular formula C11H21ClN2O3
and a molecular weight of 264.75 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;hydrochloride.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;hydrochloride |
| PubChem CID | 88710434 |
| Molecular Formula | C11H21ClN2O3 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;hydrochloride |
| SMILES | C=C(C)C(=O)OCCN(C)C.C=CC(N)=O.Cl |
| InChI | InChI=1S/C8H15NO2.C3H5NO.ClH/c1-7(2)8(10)11-6-5-9(3)4;1-2-3(4)5;/h1,5-6H2,2-4H3;2H,1H2,(H2,4,5);1H |
| InChIKey | VVIWMCIQKIUEQY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;hydrochloride?
The IUPAC name of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;hydrochloride (CID 88710434) is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;hydrochloride.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;hydrochloride?
The canonical SMILES for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;hydrochloride is C=C(C)C(=O)OCCN(C)C.C=CC(N)=O.Cl.
What is the InChIKey of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;hydrochloride?
The InChIKey is VVIWMCIQKIUEQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C3H5NO.ClH/c1-7(2)8(10)11-6-5-9(3)4;1-2-3(4)5;/h1,5-6H2,2-4H3;2H,1H2,(H2,4,5);1H.
What are the key properties of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;hydrochloride?
2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;hydrochloride has a molecular weight of 264.75 g/mol, XLogP of 0.75, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;hydrochloride is sourced from PubChem (CID 88710434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).