About bis(acetonitrile);palladium(2+)
bis(acetonitrile);palladium(2+) (PubChem CID 88710549) has the molecular formula C4H4N2Pd
and a molecular weight of 186.51 g/mol. Its IUPAC name is bis(acetonitrile);palladium(2+).
Molecular Properties
| Compound Name | bis(acetonitrile);palladium(2+) |
| PubChem CID | 88710549 |
| Molecular Formula | C4H4N2Pd |
| Molecular Weight | 186.51 g/mol |
| Exact Mass | 185.94 |
| IUPAC Name | bis(acetonitrile);palladium(2+) |
| SMILES | [CH2-]C#N.[CH2-]C#N.[Pd+2] |
| InChI | InChI=1S/2C2H2N.Pd/c2*1-2-3;/h2*1H2;/q2*-1;+2 |
| InChIKey | DBPFYDBVHYWVMD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.51 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(acetonitrile);palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(acetonitrile);palladium(2+)?
The IUPAC name of bis(acetonitrile);palladium(2+) (CID 88710549) is bis(acetonitrile);palladium(2+).
What is the SMILES notation for bis(acetonitrile);palladium(2+)?
The canonical SMILES for bis(acetonitrile);palladium(2+) is [CH2-]C#N.[CH2-]C#N.[Pd+2].
What is the InChIKey of bis(acetonitrile);palladium(2+)?
The InChIKey is DBPFYDBVHYWVMD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C2H2N.Pd/c2*1-2-3;/h2*1H2;/q2*-1;+2.
What are the key properties of bis(acetonitrile);palladium(2+)?
bis(acetonitrile);palladium(2+) has a molecular weight of 186.51 g/mol, XLogP of 0.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(acetonitrile);palladium(2+) is sourced from PubChem (CID 88710549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).