About 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]ethyl acetate;hydrate;hydrochloride
2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]ethyl acetate;hydrate;hydrochloride (PubChem CID 88710919) has the molecular formula C8H15ClN4O3S
and a molecular weight of 282.75 g/mol. Its IUPAC name is 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]ethyl acetate;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]ethyl acetate;hydrate;hydrochloride |
| PubChem CID | 88710919 |
| Molecular Formula | C8H15ClN4O3S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]ethyl acetate;hydrate;hydrochloride |
| SMILES | CC(=O)OCCc1csc(N=C(N)N)n1.Cl.O |
| InChI | InChI=1S/C8H12N4O2S.ClH.H2O/c1-5(13)14-3-2-6-4-15-8(11-6)12-7(9)10;;/h4H,2-3H2,1H3,(H4,9,10,11,12);1H;1H2 |
| InChIKey | NGJKEQGDFGAIDU-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 135.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]ethyl acetate;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]ethyl acetate;hydrate;hydrochloride?
The IUPAC name of 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]ethyl acetate;hydrate;hydrochloride (CID 88710919) is 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]ethyl acetate;hydrate;hydrochloride.
What is the SMILES notation for 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]ethyl acetate;hydrate;hydrochloride?
The canonical SMILES for 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]ethyl acetate;hydrate;hydrochloride is CC(=O)OCCc1csc(N=C(N)N)n1.Cl.O.
What is the InChIKey of 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]ethyl acetate;hydrate;hydrochloride?
The InChIKey is NGJKEQGDFGAIDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O2S.ClH.H2O/c1-5(13)14-3-2-6-4-15-8(11-6)12-7(9)10;;/h4H,2-3H2,1H3,(H4,9,10,11,12);1H;1H2.
What are the key properties of 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]ethyl acetate;hydrate;hydrochloride?
2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]ethyl acetate;hydrate;hydrochloride has a molecular weight of 282.75 g/mol, XLogP of -0.25, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]ethyl acetate;hydrate;hydrochloride is sourced from PubChem (CID 88710919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).