About N,N-bis(prop-2-enyl)-1,3-dithiolan-2-amine
N,N-bis(prop-2-enyl)-1,3-dithiolan-2-amine (PubChem CID 88711558) has the molecular formula C9H15NS2
and a molecular weight of 201.36 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-1,3-dithiolan-2-amine.
Molecular Properties
| Compound Name | N,N-bis(prop-2-enyl)-1,3-dithiolan-2-amine |
| PubChem CID | 88711558 |
| Molecular Formula | C9H15NS2 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | N,N-bis(prop-2-enyl)-1,3-dithiolan-2-amine |
| SMILES | C=CCN(CC=C)C1SCCS1 |
| InChI | InChI=1S/C9H15NS2/c1-3-5-10(6-4-2)9-11-7-8-12-9/h3-4,9H,1-2,5-8H2 |
| InChIKey | ALSVJGNIWCTRQE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(prop-2-enyl)-1,3-dithiolan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(prop-2-enyl)-1,3-dithiolan-2-amine?
The IUPAC name of N,N-bis(prop-2-enyl)-1,3-dithiolan-2-amine (CID 88711558) is N,N-bis(prop-2-enyl)-1,3-dithiolan-2-amine.
What is the SMILES notation for N,N-bis(prop-2-enyl)-1,3-dithiolan-2-amine?
The canonical SMILES for N,N-bis(prop-2-enyl)-1,3-dithiolan-2-amine is C=CCN(CC=C)C1SCCS1.
What is the InChIKey of N,N-bis(prop-2-enyl)-1,3-dithiolan-2-amine?
The InChIKey is ALSVJGNIWCTRQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NS2/c1-3-5-10(6-4-2)9-11-7-8-12-9/h3-4,9H,1-2,5-8H2.
What are the key properties of N,N-bis(prop-2-enyl)-1,3-dithiolan-2-amine?
N,N-bis(prop-2-enyl)-1,3-dithiolan-2-amine has a molecular weight of 201.36 g/mol, XLogP of 2.42, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(prop-2-enyl)-1,3-dithiolan-2-amine is sourced from PubChem (CID 88711558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).