C7H5F7N2O3 — CID 88711666
5-fluoro-6-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-1,3-diazinane-2,4-dione (PubChem CID 88711666) has the molecular formula C7H5F7N2O3 and a molecular weight of 298.11 g/mol. Its IUPAC name is 5-fluoro-6-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-1,3-diazinane-2,4-dione.
| Compound Name | 5-fluoro-6-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 88711666 |
| Molecular Formula | C7H5F7N2O3 |
| Molecular Weight | 298.11 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 5-fluoro-6-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-1,3-diazinane-2,4-dione |
| SMILES | O=C1NC(=O)C(F)C(OC(F)(C(F)F)C(F)(F)F)N1 |
| InChI | InChI=1S/C7H5F7N2O3/c8-1-2(17)15-5(18)16-3(1)19-6(11,4(9)10)7(12,13)14/h1,3-4H,(H2,15,16,17,18) |
| InChIKey | OKFAMOSNPAZMSY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.11 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |