About (Z)-3-[(Z)-2,2-dimethylnon-3-en-3-yl]oxy-2,2-dimethylnon-3-ene
(Z)-3-[(Z)-2,2-dimethylnon-3-en-3-yl]oxy-2,2-dimethylnon-3-ene (PubChem CID 88711859) has the molecular formula C22H42O
and a molecular weight of 322.58 g/mol. Its IUPAC name is (Z)-3-[(Z)-2,2-dimethylnon-3-en-3-yl]oxy-2,2-dimethylnon-3-ene.
Molecular Properties
| Compound Name | (Z)-3-[(Z)-2,2-dimethylnon-3-en-3-yl]oxy-2,2-dimethylnon-3-ene |
| PubChem CID | 88711859 |
| Molecular Formula | C22H42O |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.32 |
| IUPAC Name | (Z)-3-[(Z)-2,2-dimethylnon-3-en-3-yl]oxy-2,2-dimethylnon-3-ene |
| SMILES | CCCCC/C=C(\O/C(=C\CCCCC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H42O/c1-9-11-13-15-17-19(21(3,4)5)23-20(22(6,7)8)18-16-14-12-10-2/h17-18H,9-16H2,1-8H3/b19-17-,20-18- |
| InChIKey | CQNRHKLKNSFRBV-CLFAGFIQSA-N |
| XLogP | 8.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-[(Z)-2,2-dimethylnon-3-en-3-yl]oxy-2,2-dimethylnon-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-[(Z)-2,2-dimethylnon-3-en-3-yl]oxy-2,2-dimethylnon-3-ene?
The IUPAC name of (Z)-3-[(Z)-2,2-dimethylnon-3-en-3-yl]oxy-2,2-dimethylnon-3-ene (CID 88711859) is (Z)-3-[(Z)-2,2-dimethylnon-3-en-3-yl]oxy-2,2-dimethylnon-3-ene.
What is the SMILES notation for (Z)-3-[(Z)-2,2-dimethylnon-3-en-3-yl]oxy-2,2-dimethylnon-3-ene?
The canonical SMILES for (Z)-3-[(Z)-2,2-dimethylnon-3-en-3-yl]oxy-2,2-dimethylnon-3-ene is CCCCC/C=C(\O/C(=C\CCCCC)C(C)(C)C)C(C)(C)C.
What is the InChIKey of (Z)-3-[(Z)-2,2-dimethylnon-3-en-3-yl]oxy-2,2-dimethylnon-3-ene?
The InChIKey is CQNRHKLKNSFRBV-CLFAGFIQSA-N. The full InChI is InChI=1S/C22H42O/c1-9-11-13-15-17-19(21(3,4)5)23-20(22(6,7)8)18-16-14-12-10-2/h17-18H,9-16H2,1-8H3/b19-17-,20-18-.
What are the key properties of (Z)-3-[(Z)-2,2-dimethylnon-3-en-3-yl]oxy-2,2-dimethylnon-3-ene?
(Z)-3-[(Z)-2,2-dimethylnon-3-en-3-yl]oxy-2,2-dimethylnon-3-ene has a molecular weight of 322.58 g/mol, XLogP of 8.02, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-[(Z)-2,2-dimethylnon-3-en-3-yl]oxy-2,2-dimethylnon-3-ene is sourced from PubChem (CID 88711859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).