About 1-cyclohexyl-4,5-dimethyltetrazol-4-ium
1-cyclohexyl-4,5-dimethyltetrazol-4-ium (PubChem CID 88711982) has the molecular formula C9H17N4+
and a molecular weight of 181.26 g/mol. Its IUPAC name is 1-cyclohexyl-4,5-dimethyltetrazol-4-ium.
Molecular Properties
| Compound Name | 1-cyclohexyl-4,5-dimethyltetrazol-4-ium |
| PubChem CID | 88711982 |
| Molecular Formula | C9H17N4+ |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.14 |
| IUPAC Name | 1-cyclohexyl-4,5-dimethyltetrazol-4-ium |
| SMILES | Cc1n(C2CCCCC2)nn[n+]1C |
| InChI | InChI=1S/C9H17N4/c1-8-12(2)10-11-13(8)9-6-4-3-5-7-9/h9H,3-7H2,1-2H3/q+1 |
| InChIKey | XUONSMDRURKKDV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-4,5-dimethyltetrazol-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4,5-dimethyltetrazol-4-ium?
The IUPAC name of 1-cyclohexyl-4,5-dimethyltetrazol-4-ium (CID 88711982) is 1-cyclohexyl-4,5-dimethyltetrazol-4-ium.
What is the SMILES notation for 1-cyclohexyl-4,5-dimethyltetrazol-4-ium?
The canonical SMILES for 1-cyclohexyl-4,5-dimethyltetrazol-4-ium is Cc1n(C2CCCCC2)nn[n+]1C.
What is the InChIKey of 1-cyclohexyl-4,5-dimethyltetrazol-4-ium?
The InChIKey is XUONSMDRURKKDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N4/c1-8-12(2)10-11-13(8)9-6-4-3-5-7-9/h9H,3-7H2,1-2H3/q+1.
What are the key properties of 1-cyclohexyl-4,5-dimethyltetrazol-4-ium?
1-cyclohexyl-4,5-dimethyltetrazol-4-ium has a molecular weight of 181.26 g/mol, XLogP of 0.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4,5-dimethyltetrazol-4-ium is sourced from PubChem (CID 88711982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).