C22H30O12 — CID 88712127
[(5R,6S,7R,8R)-4,5,6-triacetyl-5-acetyloxy-6,7,8,9-tetrahydroxy-2-methyl-3-oxonon-1-en-4-yl] 2-methylprop-2-enoate (PubChem CID 88712127) has the molecular formula C22H30O12 and a molecular weight of 486.47 g/mol. Its IUPAC name is [(5R,6S,7R,8R)-4,5,6-triacetyl-5-acetyloxy-6,7,8,9-tetrahydroxy-2-methyl-3-oxonon-1-en-4-yl] 2-methylprop-2-enoate.
| Compound Name | [(5R,6S,7R,8R)-4,5,6-triacetyl-5-acetyloxy-6,7,8,9-tetrahydroxy-2-methyl-3-oxonon-1-en-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88712127 |
| Molecular Formula | C22H30O12 |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | [(5R,6S,7R,8R)-4,5,6-triacetyl-5-acetyloxy-6,7,8,9-tetrahydroxy-2-methyl-3-oxonon-1-en-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C(C)=O)(C(=O)C(=C)C)[C@@](OC(C)=O)(C(C)=O)[C@](O)(C(C)=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C22H30O12/c1-10(2)17(29)21(13(6)25,34-19(31)11(3)4)22(14(7)26,33-15(8)27)20(32,12(5)24)18(30)16(28)9-23/h16,18,23,28,30,32H,1,3,9H2,2,4-8H3/t16-,18-,20+,21?,22-/m1/s1 |
| InChIKey | RVYSOGPBIYHDHY-UJEGVSLBSA-N |
| XLogP | -1.50 |
| TPSA | 201.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|