About methylthiourea;1-phenylimidazolidine
methylthiourea;1-phenylimidazolidine (PubChem CID 88712214) has the molecular formula C11H18N4S
and a molecular weight of 238.36 g/mol. Its IUPAC name is methylthiourea;1-phenylimidazolidine.
Molecular Properties
| Compound Name | methylthiourea;1-phenylimidazolidine |
| PubChem CID | 88712214 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | methylthiourea;1-phenylimidazolidine |
| SMILES | CNC(N)=S.c1ccc(N2CCNC2)cc1 |
| InChI | InChI=1S/C9H12N2.C2H6N2S/c1-2-4-9(5-3-1)11-7-6-10-8-11;1-4-2(3)5/h1-5,10H,6-8H2;1H3,(H3,3,4,5) |
| InChIKey | DRRCACUIIPIZND-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methylthiourea;1-phenylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylthiourea;1-phenylimidazolidine?
The IUPAC name of methylthiourea;1-phenylimidazolidine (CID 88712214) is methylthiourea;1-phenylimidazolidine.
What is the SMILES notation for methylthiourea;1-phenylimidazolidine?
The canonical SMILES for methylthiourea;1-phenylimidazolidine is CNC(N)=S.c1ccc(N2CCNC2)cc1.
What is the InChIKey of methylthiourea;1-phenylimidazolidine?
The InChIKey is DRRCACUIIPIZND-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.C2H6N2S/c1-2-4-9(5-3-1)11-7-6-10-8-11;1-4-2(3)5/h1-5,10H,6-8H2;1H3,(H3,3,4,5).
What are the key properties of methylthiourea;1-phenylimidazolidine?
methylthiourea;1-phenylimidazolidine has a molecular weight of 238.36 g/mol, XLogP of 0.50, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylthiourea;1-phenylimidazolidine is sourced from PubChem (CID 88712214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).