C15H23F3N2O4S — CID 88712675
[2-(2-aminohexanoylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 88712675) has the molecular formula C15H23F3N2O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is [2-(2-aminohexanoylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [2-(2-aminohexanoylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 88712675 |
| Molecular Formula | C15H23F3N2O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | [2-(2-aminohexanoylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | CCCCC(N)C(=O)SCC(C(=O)OC(=O)[C@@H]1CCCN1)C(F)(F)F |
| InChI | InChI=1S/C15H23F3N2O4S/c1-2-3-5-10(19)14(23)25-8-9(15(16,17)18)12(21)24-13(22)11-6-4-7-20-11/h9-11,20H,2-8,19H2,1H3/t9?,10?,11-/m0/s1 |
| InChIKey | KOOSETGMKZLANS-ILDUYXDCSA-N |
| XLogP | 1.76 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|