About hydrogen peroxide;2-methyl-3-phenyldiazenylpropanenitrile
hydrogen peroxide;2-methyl-3-phenyldiazenylpropanenitrile (PubChem CID 88713139) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is hydrogen peroxide;2-methyl-3-phenyldiazenylpropanenitrile.
Molecular Properties
| Compound Name | hydrogen peroxide;2-methyl-3-phenyldiazenylpropanenitrile |
| PubChem CID | 88713139 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | hydrogen peroxide;2-methyl-3-phenyldiazenylpropanenitrile |
| SMILES | CC(C#N)C/N=N/c1ccccc1.OO |
| InChI | InChI=1S/C10H11N3.H2O2/c1-9(7-11)8-12-13-10-5-3-2-4-6-10;1-2/h2-6,9H,8H2,1H3;1-2H/b13-12+; |
| InChIKey | PSDYXLOQCWIEMW-UEIGIMKUSA-N |
| XLogP | 2.95 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hydrogen peroxide;2-methyl-3-phenyldiazenylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen peroxide;2-methyl-3-phenyldiazenylpropanenitrile?
The IUPAC name of hydrogen peroxide;2-methyl-3-phenyldiazenylpropanenitrile (CID 88713139) is hydrogen peroxide;2-methyl-3-phenyldiazenylpropanenitrile.
What is the SMILES notation for hydrogen peroxide;2-methyl-3-phenyldiazenylpropanenitrile?
The canonical SMILES for hydrogen peroxide;2-methyl-3-phenyldiazenylpropanenitrile is CC(C#N)C/N=N/c1ccccc1.OO.
What is the InChIKey of hydrogen peroxide;2-methyl-3-phenyldiazenylpropanenitrile?
The InChIKey is PSDYXLOQCWIEMW-UEIGIMKUSA-N. The full InChI is InChI=1S/C10H11N3.H2O2/c1-9(7-11)8-12-13-10-5-3-2-4-6-10;1-2/h2-6,9H,8H2,1H3;1-2H/b13-12+;.
What are the key properties of hydrogen peroxide;2-methyl-3-phenyldiazenylpropanenitrile?
hydrogen peroxide;2-methyl-3-phenyldiazenylpropanenitrile has a molecular weight of 207.23 g/mol, XLogP of 2.95, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;2-methyl-3-phenyldiazenylpropanenitrile is sourced from PubChem (CID 88713139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).