About dichloroplatinum;propan-2-ol
dichloroplatinum;propan-2-ol (PubChem CID 88713335) has the molecular formula C3H8Cl2OPt
and a molecular weight of 326.08 g/mol. Its IUPAC name is dichloroplatinum;propan-2-ol.
Molecular Properties
| Compound Name | dichloroplatinum;propan-2-ol |
| PubChem CID | 88713335 |
| Molecular Formula | C3H8Cl2OPt |
| Molecular Weight | 326.08 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | dichloroplatinum;propan-2-ol |
| SMILES | CC(C)O.Cl[Pt]Cl |
| InChI | InChI=1S/C3H8O.2ClH.Pt/c1-3(2)4;;;/h3-4H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | DBNDPQPFYROPEQ-UHFFFAOYSA-L |
| XLogP | 1.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.08 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dichloroplatinum;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum;propan-2-ol?
The IUPAC name of dichloroplatinum;propan-2-ol (CID 88713335) is dichloroplatinum;propan-2-ol.
What is the SMILES notation for dichloroplatinum;propan-2-ol?
The canonical SMILES for dichloroplatinum;propan-2-ol is CC(C)O.Cl[Pt]Cl.
What is the InChIKey of dichloroplatinum;propan-2-ol?
The InChIKey is DBNDPQPFYROPEQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H8O.2ClH.Pt/c1-3(2)4;;;/h3-4H,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichloroplatinum;propan-2-ol?
dichloroplatinum;propan-2-ol has a molecular weight of 326.08 g/mol, XLogP of 1.76, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum;propan-2-ol is sourced from PubChem (CID 88713335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).